CAS NO: 57116-45-7
Specification: Solid content 99%Min
Product Name | Pentaerythritol tris[3-(1-aziridinyl)propionate] |
Quality Standard | Solid content 99.0%Min |
Synonyms | Apa-1 Pentaerythritol-tris-(beta-n-aziridinyl)propionate Tazo, xama 7, Pentaerythritol tris(3-aziridin-1-ylpropionate) |
Structure | |
SMILES | O=C(CCN1CC1)OCC(CO)(COC(=O)CCN2CC2)COC(=O)CCN3CC3 |
Appearance | Colorless to light yellow liquid |
Solid content(w/w) | 99%Min |
Viscosity (25°C) | 1000-4000cp |
PH (25°C) | 8.0-11.0 |
Density (20°C) | 1.18-1.20KG/L |
aziridinyl | 6.74 mol/KG |
Hydroxyl | 2.34 mol/KG |
Freezing point | ≤-10°C |
Solubility | be soluble in water, alcohol, ketone and ester |
Packing | 25KG net plastic liner iron drum |