CAS NO: 64265-57-2
Specification: Solid content 99%Min
Product Name | Trimethylolpropane tris(2-methyl-1-aziridinepropionate) |
Quality Standard | Solid content 99.0%Min |
Synonyms | 2-Methyl-1-aziridinepropanoic acid 2-ethyl-2 -[[3-(2-methyl-1-aziridinyl)-1-oxopropoxy]methyl]-1,3-propanediyl ester |
Structure | ![]() |
SMILES | CCC(COC(=O)CCN1CC1C)(COC(=O)CCN2CC2C)OC(=O)CCN3CC3C |
Appearance | Colorless to light yellow liquid |
Solid content(w/w) | 99%Min |
Viscosity (25°C) | 180-220mPa.s |
PH (25°C) | 8.0-10.2 |
Density (20°C) | 1.08KG/L |
2-methyl-1-aziridine | 6.0-6.2mol/KG |
Freezing point | ≤-15°C |
Solubility | be soluble in water, alcohol, ketone and ester |
Packing | 25KG net plastic liner iron drum |