CAS NO: 16611-67-9
Specification: 98%Min
| Product Name | 2,5-Dichlorobenzophenone |
| Quality Standard | 98% |
| Synonyms | (2,5-dichlorophenyl)-phenylmethanone |
| Structure | ![]() |
| SMILES | ClC2=C(C(=O)C1=CC=CC=C1)C=C(C=C2)Cl |
| InChI | 1S/C13H8Cl2O/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8H |
| InChIKey | FAVKIHMGRWRACA-UHFFFAOYSA-N |



